C6H13N — CID 58412242
(3R)-1,3-dimethylpyrrolidine (PubChem CID 58412242) has the molecular formula C6H13N and a molecular weight of 99.18 g/mol. Its IUPAC name is (3R)-1,3-dimethylpyrrolidine.
| Compound Name | (3R)-1,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 58412242 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | (3R)-1,3-dimethylpyrrolidine |
| SMILES | C[C@@H]1CCN(C)C1 |
| InChI | InChI=1S/C6H13N/c1-6-3-4-7(2)5-6/h6H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | IGNGFGXAWDQJGP-ZCFIWIBFSA-N |
| XLogP | 0.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |