C15H37N3 — CID 159125347
1,4-dimethylpiperazine;1,3-dimethylpiperidine;methane (PubChem CID 159125347) has the molecular formula C15H37N3 and a molecular weight of 259.48 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;1,3-dimethylpiperidine;methane.
| Compound Name | 1,4-dimethylpiperazine;1,3-dimethylpiperidine;methane |
|---|---|
| PubChem CID | 159125347 |
| Molecular Formula | C15H37N3 |
| Molecular Weight | 259.48 g/mol |
| Exact Mass | 259.30 |
| IUPAC Name | 1,4-dimethylpiperazine;1,3-dimethylpiperidine;methane |
| SMILES | C.C.CC1CCCN(C)C1.CN1CCN(C)CC1 |
| InChI | InChI=1S/C7H15N.C6H14N2.2CH4/c1-7-4-3-5-8(2)6-7;1-7-3-5-8(2)6-4-7;;/h7H,3-6H2,1-2H3;3-6H2,1-2H3;2*1H4 |
| InChIKey | KGEZABMLGZIYPA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |