C15H32N2 — CID 10610105
1,5,8,11-tetramethyl-1,5-diazacyclotridecane (PubChem CID 10610105) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 1,5,8,11-tetramethyl-1,5-diazacyclotridecane.
| Compound Name | 1,5,8,11-tetramethyl-1,5-diazacyclotridecane |
|---|---|
| PubChem CID | 10610105 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 1,5,8,11-tetramethyl-1,5-diazacyclotridecane |
| SMILES | CC1CCC(C)CCN(C)CCCN(C)CC1 |
| InChI | InChI=1S/C15H32N2/c1-14-6-7-15(2)9-13-17(4)11-5-10-16(3)12-8-14/h14-15H,5-13H2,1-4H3 |
| InChIKey | HXMHFLBFCCNNGT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |