About 1,4-dimethylpiperidine;ethane;heptane
1,4-dimethylpiperidine;ethane;heptane (PubChem CID 156708934) has the molecular formula C20H49N
and a molecular weight of 303.62 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;ethane;heptane.
Molecular Properties
| Compound Name | 1,4-dimethylpiperidine;ethane;heptane |
| PubChem CID | 156708934 |
| Molecular Formula | C20H49N |
| Molecular Weight | 303.62 g/mol |
| Exact Mass | 303.39 |
| IUPAC Name | 1,4-dimethylpiperidine;ethane;heptane |
| SMILES | CC.CC.CC.CC1CCN(C)CC1.CCCCCCC |
| InChI | InChI=1S/C7H15N.C7H16.3C2H6/c1-7-3-5-8(2)6-4-7;1-3-5-7-6-4-2;3*1-2/h7H,3-6H2,1-2H3;3-7H2,1-2H3;3*1-2H3 |
| InChIKey | JIEQVIOKTNDYSX-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethylpiperidine;ethane;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperidine;ethane;heptane?
The IUPAC name of 1,4-dimethylpiperidine;ethane;heptane (CID 156708934) is 1,4-dimethylpiperidine;ethane;heptane.
What is the SMILES notation for 1,4-dimethylpiperidine;ethane;heptane?
The canonical SMILES for 1,4-dimethylpiperidine;ethane;heptane is CC.CC.CC.CC1CCN(C)CC1.CCCCCCC.
What is the InChIKey of 1,4-dimethylpiperidine;ethane;heptane?
The InChIKey is JIEQVIOKTNDYSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C7H16.3C2H6/c1-7-3-5-8(2)6-4-7;1-3-5-7-6-4-2;3*1-2/h7H,3-6H2,1-2H3;3-7H2,1-2H3;3*1-2H3.
What are the key properties of 1,4-dimethylpiperidine;ethane;heptane?
1,4-dimethylpiperidine;ethane;heptane has a molecular weight of 303.62 g/mol, XLogP of 7.40, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperidine;ethane;heptane is sourced from PubChem (CID 156708934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).