C20H49N — CID 156708934
1,4-dimethylpiperidine;ethane;heptane (PubChem CID 156708934) has the molecular formula C20H49N and a molecular weight of 303.62 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;ethane;heptane.
| Compound Name | 1,4-dimethylpiperidine;ethane;heptane |
|---|---|
| PubChem CID | 156708934 |
| Molecular Formula | C20H49N |
| Molecular Weight | 303.62 g/mol |
| Exact Mass | 303.39 |
| IUPAC Name | 1,4-dimethylpiperidine;ethane;heptane |
| SMILES | CC.CC.CC.CC1CCN(C)CC1.CCCCCCC |
| InChI | InChI=1S/C7H15N.C7H16.3C2H6/c1-7-3-5-8(2)6-4-7;1-3-5-7-6-4-2;3*1-2/h7H,3-6H2,1-2H3;3-7H2,1-2H3;3*1-2H3 |
| InChIKey | JIEQVIOKTNDYSX-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|