About (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal
(3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal (PubChem CID 145076534) has the molecular formula C20H38N2O3
and a molecular weight of 354.54 g/mol. Its IUPAC name is (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal.
Molecular Properties
| Compound Name | (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal |
| PubChem CID | 145076534 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal |
| SMILES | CC.CC1CC(=O)N(CCCCCCC=O)C1=O.C[C@H]1CCN(C)C1 |
| InChI | InChI=1S/C12H19NO3.C6H13N.C2H6/c1-10-9-11(15)13(12(10)16)7-5-3-2-4-6-8-14;1-6-3-4-7(2)5-6;1-2/h8,10H,2-7,9H2,1H3;6H,3-5H2,1-2H3;1-2H3/t;6-;/m.0./s1 |
| InChIKey | YGNDWPPVHARKRF-MPDITTGVSA-N |
| XLogP | 3.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal?
The IUPAC name of (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal (CID 145076534) is (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal.
What is the SMILES notation for (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal?
The canonical SMILES for (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal is CC.CC1CC(=O)N(CCCCCCC=O)C1=O.C[C@H]1CCN(C)C1.
What is the InChIKey of (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal?
The InChIKey is YGNDWPPVHARKRF-MPDITTGVSA-N. The full InChI is InChI=1S/C12H19NO3.C6H13N.C2H6/c1-10-9-11(15)13(12(10)16)7-5-3-2-4-6-8-14;1-6-3-4-7(2)5-6;1-2/h8,10H,2-7,9H2,1H3;6H,3-5H2,1-2H3;1-2H3/t;6-;/m.0./s1.
What are the key properties of (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal?
(3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal has a molecular weight of 354.54 g/mol, XLogP of 3.52, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal is sourced from PubChem (CID 145076534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).