C20H38N2O3 — CID 145076534
(3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal (PubChem CID 145076534) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal.
| Compound Name | (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal |
|---|---|
| PubChem CID | 145076534 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | (3S)-1,3-dimethylpyrrolidine;ethane;7-(3-methyl-2,5-dioxopyrrolidin-1-yl)heptanal |
| SMILES | CC.CC1CC(=O)N(CCCCCCC=O)C1=O.C[C@H]1CCN(C)C1 |
| InChI | InChI=1S/C12H19NO3.C6H13N.C2H6/c1-10-9-11(15)13(12(10)16)7-5-3-2-4-6-8-14;1-6-3-4-7(2)5-6;1-2/h8,10H,2-7,9H2,1H3;6H,3-5H2,1-2H3;1-2H3/t;6-;/m.0./s1 |
| InChIKey | YGNDWPPVHARKRF-MPDITTGVSA-N |
| XLogP | 3.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|