C13H21NO3 — CID 130295873
2-ethyl-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanal (PubChem CID 130295873) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-ethyl-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanal.
| Compound Name | 2-ethyl-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanal |
|---|---|
| PubChem CID | 130295873 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-ethyl-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanal |
| SMILES | CCC(C=O)CCCCN1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C13H21NO3/c1-3-11(9-15)6-4-5-7-14-12(16)8-10(2)13(14)17/h9-11H,3-8H2,1-2H3 |
| InChIKey | IXPJNPRKXASRSR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|