C13H25N3O3 — CID 153342824
ethane;6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanehydrazide (PubChem CID 153342824) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is ethane;6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanehydrazide.
| Compound Name | ethane;6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanehydrazide |
|---|---|
| PubChem CID | 153342824 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | ethane;6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanehydrazide |
| SMILES | CC.CC1CC(=O)N(CCCCCC(=O)NN)C1=O |
| InChI | InChI=1S/C11H19N3O3.C2H6/c1-8-7-10(16)14(11(8)17)6-4-2-3-5-9(15)13-12;1-2/h8H,2-7,12H2,1H3,(H,13,15);1-2H3 |
| InChIKey | QNKLIKVLANMUJW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|