C22H29N3 — CID 124814478
(9aR)-2-(2,2-diphenylethyl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine (PubChem CID 124814478) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is (9aR)-2-(2,2-diphenylethyl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine.
| Compound Name | (9aR)-2-(2,2-diphenylethyl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124814478 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | (9aR)-2-(2,2-diphenylethyl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
| SMILES | CN1CCN2CCN(CC(c3ccccc3)c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C22H29N3/c1-23-12-14-25-15-13-24(17-21(25)16-23)18-22(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,21-22H,12-18H2,1H3/t21-/m1/s1 |
| InChIKey | VJGQEVQPAUCVFP-OAQYLSRUSA-N |
| XLogP | 2.75 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |