C15H25N3O — CID 99930669
(9aR)-2-[(5-ethylfuran-2-yl)methyl]-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine (PubChem CID 99930669) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (9aR)-2-[(5-ethylfuran-2-yl)methyl]-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine.
| Compound Name | (9aR)-2-[(5-ethylfuran-2-yl)methyl]-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 99930669 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (9aR)-2-[(5-ethylfuran-2-yl)methyl]-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
| SMILES | CCc1ccc(CN2CCN3CCN(C)C[C@@H]3C2)o1 |
| InChI | InChI=1S/C15H25N3O/c1-3-14-4-5-15(19-14)12-17-7-9-18-8-6-16(2)10-13(18)11-17/h4-5,13H,3,6-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | YATWVNYXCRJWIU-CYBMUJFWSA-N |
| XLogP | 1.27 |
| TPSA | 22.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |