C16H23F2N3O — CID 99972713
(9aR)-2-[(2,6-difluoro-4-methoxyphenyl)methyl]-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine (PubChem CID 99972713) has the molecular formula C16H23F2N3O and a molecular weight of 311.38 g/mol. Its IUPAC name is (9aR)-2-[(2,6-difluoro-4-methoxyphenyl)methyl]-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine.
| Compound Name | (9aR)-2-[(2,6-difluoro-4-methoxyphenyl)methyl]-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 99972713 |
| Molecular Formula | C16H23F2N3O |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (9aR)-2-[(2,6-difluoro-4-methoxyphenyl)methyl]-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
| SMILES | COc1cc(F)c(CN2CCN3CCN(C)C[C@@H]3C2)c(F)c1 |
| InChI | InChI=1S/C16H23F2N3O/c1-19-3-5-21-6-4-20(10-12(21)9-19)11-14-15(17)7-13(22-2)8-16(14)18/h7-8,12H,3-6,9-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | CMEAJDSYRMEESW-GFCCVEGCSA-N |
| XLogP | 1.40 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |