C8H17N3S — CID 142537625
2-methylsulfanyl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine (PubChem CID 142537625) has the molecular formula C8H17N3S and a molecular weight of 187.31 g/mol. Its IUPAC name is 2-methylsulfanyl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine.
| Compound Name | 2-methylsulfanyl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 142537625 |
| Molecular Formula | C8H17N3S |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-methylsulfanyl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine |
| SMILES | CSN1CCN2CCNCC2C1 |
| InChI | InChI=1S/C8H17N3S/c1-12-11-5-4-10-3-2-9-6-8(10)7-11/h8-9H,2-7H2,1H3 |
| InChIKey | BZVKBOOTXPIKNL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|