C12H25N3 — CID 167201923
2-pentan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine (PubChem CID 167201923) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-pentan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine.
| Compound Name | 2-pentan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 167201923 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 2-pentan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine |
| SMILES | CCCC(C)N1CCN2CCNCC2C1 |
| InChI | InChI=1S/C12H25N3/c1-3-4-11(2)15-8-7-14-6-5-13-9-12(14)10-15/h11-13H,3-10H2,1-2H3 |
| InChIKey | PUANUXWJMOWEFX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |