About 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine
1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine (PubChem CID 116535679) has the molecular formula C13H24F3N3
and a molecular weight of 279.35 g/mol. Its IUPAC name is 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine.
Molecular Properties
| Compound Name | 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine |
| PubChem CID | 116535679 |
| Molecular Formula | C13H24F3N3 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine |
| SMILES | CC(CCCC(F)(F)F)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C13H24F3N3/c1-11(3-2-4-13(14,15)16)19-9-12(10-19)18-7-5-17-6-8-18/h11-12,17H,2-10H2,1H3 |
| InChIKey | JYFNOYDWMQZFTK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine?
The IUPAC name of 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine (CID 116535679) is 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine.
What is the SMILES notation for 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine?
The canonical SMILES for 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine is CC(CCCC(F)(F)F)N1CC(N2CCNCC2)C1.
What is the InChIKey of 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine?
The InChIKey is JYFNOYDWMQZFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F3N3/c1-11(3-2-4-13(14,15)16)19-9-12(10-19)18-7-5-17-6-8-18/h11-12,17H,2-10H2,1H3.
What are the key properties of 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine?
1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine has a molecular weight of 279.35 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(6,6,6-trifluorohexan-2-yl)azetidin-3-yl]piperazine is sourced from PubChem (CID 116535679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).