C10H19F3N2 — CID 116535635
1-(6,6,6-trifluorohexan-2-yl)pyrrolidin-3-amine (PubChem CID 116535635) has the molecular formula C10H19F3N2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 1-(6,6,6-trifluorohexan-2-yl)pyrrolidin-3-amine.
| Compound Name | 1-(6,6,6-trifluorohexan-2-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 116535635 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-(6,6,6-trifluorohexan-2-yl)pyrrolidin-3-amine |
| SMILES | CC(CCCC(F)(F)F)N1CCC(N)C1 |
| InChI | InChI=1S/C10H19F3N2/c1-8(3-2-5-10(11,12)13)15-6-4-9(14)7-15/h8-9H,2-7,14H2,1H3 |
| InChIKey | ZFPXLAYIKCEOHX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |