C13H22F3NO2 — CID 116536242
2-[1-(6,6,6-trifluorohexan-2-yl)piperidin-4-yl]acetic acid (PubChem CID 116536242) has the molecular formula C13H22F3NO2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[1-(6,6,6-trifluorohexan-2-yl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(6,6,6-trifluorohexan-2-yl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 116536242 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[1-(6,6,6-trifluorohexan-2-yl)piperidin-4-yl]acetic acid |
| SMILES | CC(CCCC(F)(F)F)N1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C13H22F3NO2/c1-10(3-2-6-13(14,15)16)17-7-4-11(5-8-17)9-12(18)19/h10-11H,2-9H2,1H3,(H,18,19) |
| InChIKey | DIFICSVFWSOOGJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |