C20H28F3NO2 — CID 70327368
2-[1-[(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentyl]piperidin-4-yl]acetic acid (PubChem CID 70327368) has the molecular formula C20H28F3NO2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[1-[(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 70327368 |
| Molecular Formula | C20H28F3NO2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-[1-[(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentyl]piperidin-4-yl]acetic acid |
| SMILES | CC(C)CC[C@H](c1ccc(C(F)(F)F)cc1)N1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H28F3NO2/c1-14(2)3-8-18(16-4-6-17(7-5-16)20(21,22)23)24-11-9-15(10-12-24)13-19(25)26/h4-7,14-15,18H,3,8-13H2,1-2H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | DIZIFYUHBJMNHH-GOSISDBHSA-N |
| XLogP | 5.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |