C27H32F3NO3 — CID 87447698
2-[1-[1-(4-formylphenyl)-4-methylpentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid (PubChem CID 87447698) has the molecular formula C27H32F3NO3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[1-[1-(4-formylphenyl)-4-methylpentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[1-(4-formylphenyl)-4-methylpentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 87447698 |
| Molecular Formula | C27H32F3NO3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2-[1-[1-(4-formylphenyl)-4-methylpentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid |
| SMILES | CC(C)CCC(c1ccc(C=O)cc1)N1CCC(CC(=O)O)CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H32F3NO3/c1-18(2)3-12-24(21-6-4-19(17-32)5-7-21)31-14-13-20(16-26(33)34)15-25(31)22-8-10-23(11-9-22)27(28,29)30/h4-11,17-18,20,24-25H,3,12-16H2,1-2H3,(H,33,34) |
| InChIKey | FXSFFXVCCSZRNH-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|