C30H38F3NO — CID 89105449
3-[(4R)-1-[(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentyl]-2-(4-prop-2-enylphenyl)piperidin-4-yl]prop-1-en-2-ol (PubChem CID 89105449) has the molecular formula C30H38F3NO and a molecular weight of 485.63 g/mol. Its IUPAC name is 3-[(4R)-1-[(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentyl]-2-(4-prop-2-enylphenyl)piperidin-4-yl]prop-1-en-2-ol.
| Compound Name | 3-[(4R)-1-[(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentyl]-2-(4-prop-2-enylphenyl)piperidin-4-yl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 89105449 |
| Molecular Formula | C30H38F3NO |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 3-[(4R)-1-[(1R)-4-methyl-1-[4-(trifluoromethyl)phenyl]pentyl]-2-(4-prop-2-enylphenyl)piperidin-4-yl]prop-1-en-2-ol |
| SMILES | C=CCc1ccc(C2C[C@H](CC(=C)O)CCN2[C@H](CCC(C)C)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H38F3NO/c1-5-6-23-8-10-26(11-9-23)29-20-24(19-22(4)35)17-18-34(29)28(16-7-21(2)3)25-12-14-27(15-13-25)30(31,32)33/h5,8-15,21,24,28-29,35H,1,4,6-7,16-20H2,2-3H3/t24-,28+,29?/m0/s1 |
| InChIKey | XWPBNNBOAJDBKX-KUGOCJFLSA-N |
| XLogP | 8.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|