C29H36F3NO2 — CID 89105416
2-[(4R)-1-[(1R)-4-methyl-1-(4-prop-2-enylphenyl)pentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid (PubChem CID 89105416) has the molecular formula C29H36F3NO2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-[(4R)-1-[(1R)-4-methyl-1-(4-prop-2-enylphenyl)pentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[(4R)-1-[(1R)-4-methyl-1-(4-prop-2-enylphenyl)pentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 89105416 |
| Molecular Formula | C29H36F3NO2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 2-[(4R)-1-[(1R)-4-methyl-1-(4-prop-2-enylphenyl)pentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetic acid |
| SMILES | C=CCc1ccc([C@@H](CCC(C)C)N2CC[C@@H](CC(=O)O)CC2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H36F3NO2/c1-4-5-21-7-9-23(10-8-21)26(15-6-20(2)3)33-17-16-22(19-28(34)35)18-27(33)24-11-13-25(14-12-24)29(30,31)32/h4,7-14,20,22,26-27H,1,5-6,15-19H2,2-3H3,(H,34,35)/t22-,26-,27?/m1/s1 |
| InChIKey | BKGOAJDPJUFPBM-KQKPCWFXSA-N |
| XLogP | 7.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|