C30H37F3NO2- — CID 86618004
2-[(2S,4R)-1-[(1R)-4-methyl-1-(4-prop-2-enylphenyl)pentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propanoate (PubChem CID 86618004) has the molecular formula C30H37F3NO2- and a molecular weight of 500.63 g/mol. Its IUPAC name is 2-[(2S,4R)-1-[(1R)-4-methyl-1-(4-prop-2-enylphenyl)pentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propanoate.
| Compound Name | 2-[(2S,4R)-1-[(1R)-4-methyl-1-(4-prop-2-enylphenyl)pentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propanoate |
|---|---|
| PubChem CID | 86618004 |
| Molecular Formula | C30H37F3NO2- |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 2-[(2S,4R)-1-[(1R)-4-methyl-1-(4-prop-2-enylphenyl)pentyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propanoate |
| SMILES | C=CCc1ccc([C@@H](CCC(C)C)N2CC[C@@H](C(C)C(=O)[O-])C[C@H]2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H38F3NO2/c1-5-6-22-8-10-23(11-9-22)27(16-7-20(2)3)34-18-17-25(21(4)29(35)36)19-28(34)24-12-14-26(15-13-24)30(31,32)33/h5,8-15,20-21,25,27-28H,1,6-7,16-19H2,2-4H3,(H,35,36)/p-1/t21?,25-,27-,28+/m1/s1 |
| InChIKey | XLHQXRYJUZFHEE-NCTBNLPSSA-M |
| XLogP | 6.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|