C21H30F3NO2 — CID 167541486
tert-butyl 2-[1-[1-[4-(trifluoromethyl)phenyl]propyl]piperidin-4-yl]acetate (PubChem CID 167541486) has the molecular formula C21H30F3NO2 and a molecular weight of 385.47 g/mol. Its IUPAC name is tert-butyl 2-[1-[1-[4-(trifluoromethyl)phenyl]propyl]piperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[1-[4-(trifluoromethyl)phenyl]propyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 167541486 |
| Molecular Formula | C21H30F3NO2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | tert-butyl 2-[1-[1-[4-(trifluoromethyl)phenyl]propyl]piperidin-4-yl]acetate |
| SMILES | CCC(c1ccc(C(F)(F)F)cc1)N1CCC(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H30F3NO2/c1-5-18(16-6-8-17(9-7-16)21(22,23)24)25-12-10-15(11-13-25)14-19(26)27-20(2,3)4/h6-9,15,18H,5,10-14H2,1-4H3 |
| InChIKey | BGELOOKHXCZWFG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |