C12H22F3N3O — CID 116535670
N-methyl-1-(6,6,6-trifluorohexan-2-yl)piperazine-2-carboxamide (PubChem CID 116535670) has the molecular formula C12H22F3N3O and a molecular weight of 281.32 g/mol. Its IUPAC name is N-methyl-1-(6,6,6-trifluorohexan-2-yl)piperazine-2-carboxamide.
| Compound Name | N-methyl-1-(6,6,6-trifluorohexan-2-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 116535670 |
| Molecular Formula | C12H22F3N3O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-methyl-1-(6,6,6-trifluorohexan-2-yl)piperazine-2-carboxamide |
| SMILES | CNC(=O)C1CNCCN1C(C)CCCC(F)(F)F |
| InChI | InChI=1S/C12H22F3N3O/c1-9(4-3-5-12(13,14)15)18-7-6-17-8-10(18)11(19)16-2/h9-10,17H,3-8H2,1-2H3,(H,16,19) |
| InChIKey | KMPACAYPDFFICU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |