About 1-heptan-2-ylpiperazine
1-heptan-2-ylpiperazine (PubChem CID 61464712) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-heptan-2-ylpiperazine.
Molecular Properties
| Compound Name | 1-heptan-2-ylpiperazine |
| PubChem CID | 61464712 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-heptan-2-ylpiperazine |
| SMILES | CCCCCC(C)N1CCNCC1 |
| InChI | InChI=1S/C11H24N2/c1-3-4-5-6-11(2)13-9-7-12-8-10-13/h11-12H,3-10H2,1-2H3 |
| InChIKey | XJCCOJFOMZJFAX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-heptan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptan-2-ylpiperazine?
The IUPAC name of 1-heptan-2-ylpiperazine (CID 61464712) is 1-heptan-2-ylpiperazine.
What is the SMILES notation for 1-heptan-2-ylpiperazine?
The canonical SMILES for 1-heptan-2-ylpiperazine is CCCCCC(C)N1CCNCC1.
What is the InChIKey of 1-heptan-2-ylpiperazine?
The InChIKey is XJCCOJFOMZJFAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-3-4-5-6-11(2)13-9-7-12-8-10-13/h11-12H,3-10H2,1-2H3.
What are the key properties of 1-heptan-2-ylpiperazine?
1-heptan-2-ylpiperazine has a molecular weight of 184.33 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptan-2-ylpiperazine is sourced from PubChem (CID 61464712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).