About cyanamide;cyclopentane;1-hexan-2-ylpiperazine
cyanamide;cyclopentane;1-hexan-2-ylpiperazine (PubChem CID 143761748) has the molecular formula C16H34N4
and a molecular weight of 282.48 g/mol. Its IUPAC name is cyanamide;cyclopentane;1-hexan-2-ylpiperazine.
Molecular Properties
| Compound Name | cyanamide;cyclopentane;1-hexan-2-ylpiperazine |
| PubChem CID | 143761748 |
| Molecular Formula | C16H34N4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | cyanamide;cyclopentane;1-hexan-2-ylpiperazine |
| SMILES | C1CCCC1.CCCCC(C)N1CCNCC1.N#CN |
| InChI | InChI=1S/C10H22N2.C5H10.CH2N2/c1-3-4-5-10(2)12-8-6-11-7-9-12;1-2-4-5-3-1;2-1-3/h10-11H,3-9H2,1-2H3;1-5H2;2H2 |
| InChIKey | LDDJLRPYXWLZAQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze cyanamide;cyclopentane;1-hexan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanamide;cyclopentane;1-hexan-2-ylpiperazine?
The IUPAC name of cyanamide;cyclopentane;1-hexan-2-ylpiperazine (CID 143761748) is cyanamide;cyclopentane;1-hexan-2-ylpiperazine.
What is the SMILES notation for cyanamide;cyclopentane;1-hexan-2-ylpiperazine?
The canonical SMILES for cyanamide;cyclopentane;1-hexan-2-ylpiperazine is C1CCCC1.CCCCC(C)N1CCNCC1.N#CN.
What is the InChIKey of cyanamide;cyclopentane;1-hexan-2-ylpiperazine?
The InChIKey is LDDJLRPYXWLZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2.C5H10.CH2N2/c1-3-4-5-10(2)12-8-6-11-7-9-12;1-2-4-5-3-1;2-1-3/h10-11H,3-9H2,1-2H3;1-5H2;2H2.
What are the key properties of cyanamide;cyclopentane;1-hexan-2-ylpiperazine?
cyanamide;cyclopentane;1-hexan-2-ylpiperazine has a molecular weight of 282.48 g/mol, XLogP of 2.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanamide;cyclopentane;1-hexan-2-ylpiperazine is sourced from PubChem (CID 143761748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).