C11H21N3 — CID 61353151
2-(1,4-diazepan-1-yl)hexanenitrile (PubChem CID 61353151) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)hexanenitrile.
| Compound Name | 2-(1,4-diazepan-1-yl)hexanenitrile |
|---|---|
| PubChem CID | 61353151 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)hexanenitrile |
| SMILES | CCCCC(C#N)N1CCCNCC1 |
| InChI | InChI=1S/C11H21N3/c1-2-3-5-11(10-12)14-8-4-6-13-7-9-14/h11,13H,2-9H2,1H3 |
| InChIKey | UWAMJHGBPPADGV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |