About 1-hexan-2-yl-1,5-diazocane
1-hexan-2-yl-1,5-diazocane (PubChem CID 62200653) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-hexan-2-yl-1,5-diazocane.
Molecular Properties
| Compound Name | 1-hexan-2-yl-1,5-diazocane |
| PubChem CID | 62200653 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-hexan-2-yl-1,5-diazocane |
| SMILES | CCCCC(C)N1CCCNCCC1 |
| InChI | InChI=1S/C12H26N2/c1-3-4-7-12(2)14-10-5-8-13-9-6-11-14/h12-13H,3-11H2,1-2H3 |
| InChIKey | UTEYNNSOOMBEEB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-hexan-2-yl-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexan-2-yl-1,5-diazocane?
The IUPAC name of 1-hexan-2-yl-1,5-diazocane (CID 62200653) is 1-hexan-2-yl-1,5-diazocane.
What is the SMILES notation for 1-hexan-2-yl-1,5-diazocane?
The canonical SMILES for 1-hexan-2-yl-1,5-diazocane is CCCCC(C)N1CCCNCCC1.
What is the InChIKey of 1-hexan-2-yl-1,5-diazocane?
The InChIKey is UTEYNNSOOMBEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-3-4-7-12(2)14-10-5-8-13-9-6-11-14/h12-13H,3-11H2,1-2H3.
What are the key properties of 1-hexan-2-yl-1,5-diazocane?
1-hexan-2-yl-1,5-diazocane has a molecular weight of 198.35 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexan-2-yl-1,5-diazocane is sourced from PubChem (CID 62200653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).