C11H21F3N2 — CID 171308963
1-[(2S)-1,1,1-trifluoroheptan-2-yl]piperazine (PubChem CID 171308963) has the molecular formula C11H21F3N2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 1-[(2S)-1,1,1-trifluoroheptan-2-yl]piperazine.
| Compound Name | 1-[(2S)-1,1,1-trifluoroheptan-2-yl]piperazine |
|---|---|
| PubChem CID | 171308963 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-[(2S)-1,1,1-trifluoroheptan-2-yl]piperazine |
| SMILES | CCCCC[C@H](N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2/c1-2-3-4-5-10(11(12,13)14)16-8-6-15-7-9-16/h10,15H,2-9H2,1H3/t10-/m0/s1 |
| InChIKey | OCROICSKFVSGLH-JTQLQIEISA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|