C9H19Cl2F3N2 — CID 171276178
1-[(2S)-1,1,1-trifluoropentan-2-yl]piperazine;dihydrochloride (PubChem CID 171276178) has the molecular formula C9H19Cl2F3N2 and a molecular weight of 283.17 g/mol. Its IUPAC name is 1-[(2S)-1,1,1-trifluoropentan-2-yl]piperazine;dihydrochloride.
| Compound Name | 1-[(2S)-1,1,1-trifluoropentan-2-yl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171276178 |
| Molecular Formula | C9H19Cl2F3N2 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-[(2S)-1,1,1-trifluoropentan-2-yl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](N1CCNCC1)C(F)(F)F.Cl.Cl |
| InChI | InChI=1S/C9H17F3N2.2ClH/c1-2-3-8(9(10,11)12)14-6-4-13-5-7-14;;/h8,13H,2-7H2,1H3;2*1H/t8-;;/m0../s1 |
| InChIKey | IHJPSEABLWBIEE-JZGIKJSDSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |