C9H20N2O — CID 142143795
(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine;methanol (PubChem CID 142143795) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is (9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine;methanol.
| Compound Name | (9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine;methanol |
|---|---|
| PubChem CID | 142143795 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine;methanol |
| SMILES | C1CCN2CCNC[C@H]2C1.CO |
| InChI | InChI=1S/C8H16N2.CH4O/c1-2-5-10-6-4-9-7-8(10)3-1;1-2/h8-9H,1-7H2;2H,1H3/t8-;/m1./s1 |
| InChIKey | OKVMZWGPNNWCKF-DDWIOCJRSA-N |
| XLogP | 0.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |