C11H22ClN3 — CID 131204117
(3aS,6aR)-5-piperidin-3-yl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 131204117) has the molecular formula C11H22ClN3 and a molecular weight of 231.77 g/mol. Its IUPAC name is (3aS,6aR)-5-piperidin-3-yl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aS,6aR)-5-piperidin-3-yl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 131204117 |
| Molecular Formula | C11H22ClN3 |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | (3aS,6aR)-5-piperidin-3-yl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | C1CNCC(N2C[C@H]3CNC[C@H]3C2)C1.Cl |
| InChI | InChI=1S/C11H21N3.ClH/c1-2-11(6-12-3-1)14-7-9-4-13-5-10(9)8-14;/h9-13H,1-8H2;1H/t9-,10+,11?; |
| InChIKey | LYDMYRDENBMSQO-DIVWUKMWSA-N |
| XLogP | 0.31 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |