C13H17NO — CID 15468731
1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridin-3-ol (PubChem CID 15468731) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridin-3-ol.
| Compound Name | 1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 15468731 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridin-3-ol |
| SMILES | C[C@H](c1ccccc1)N1CC=CC(O)C1 |
| InChI | InChI=1S/C13H17NO/c1-11(12-6-3-2-4-7-12)14-9-5-8-13(15)10-14/h2-8,11,13,15H,9-10H2,1H3/t11-,13?/m1/s1 |
| InChIKey | URNGEGPJGAVTPW-JTDNENJMSA-N |
| XLogP | 1.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|