C14H23NOSi — CID 14089790
trimethyl-[1-(1-phenylethyl)azetidin-3-yl]oxysilane (PubChem CID 14089790) has the molecular formula C14H23NOSi and a molecular weight of 249.43 g/mol. Its IUPAC name is trimethyl-[1-(1-phenylethyl)azetidin-3-yl]oxysilane.
| Compound Name | trimethyl-[1-(1-phenylethyl)azetidin-3-yl]oxysilane |
|---|---|
| PubChem CID | 14089790 |
| Molecular Formula | C14H23NOSi |
| Molecular Weight | 249.43 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | trimethyl-[1-(1-phenylethyl)azetidin-3-yl]oxysilane |
| SMILES | CC(c1ccccc1)N1CC(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C14H23NOSi/c1-12(13-8-6-5-7-9-13)15-10-14(11-15)16-17(2,3)4/h5-9,12,14H,10-11H2,1-4H3 |
| InChIKey | AJIZXHVQPRGLGM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|