C16H19NO — CID 91570154
2-[(1S)-1-phenylethyl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole (PubChem CID 91570154) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-[(1S)-1-phenylethyl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole.
| Compound Name | 2-[(1S)-1-phenylethyl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole |
|---|---|
| PubChem CID | 91570154 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[(1S)-1-phenylethyl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole |
| SMILES | C[C@@H](c1ccccc1)N1CC2C3C=CC(O3)C2C1 |
| InChI | InChI=1S/C16H19NO/c1-11(12-5-3-2-4-6-12)17-9-13-14(10-17)16-8-7-15(13)18-16/h2-8,11,13-16H,9-10H2,1H3/t11-,13?,14?,15?,16?/m0/s1 |
| InChIKey | DMSCJCVBJYGPCG-DSGUZJNWSA-N |
| XLogP | 2.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|