C28H32N2OSi — CID 140732658
tert-butyl-[1-[1-(4-isocyanophenyl)ethyl]azetidin-3-yl]oxy-diphenylsilane (PubChem CID 140732658) has the molecular formula C28H32N2OSi and a molecular weight of 440.66 g/mol. Its IUPAC name is tert-butyl-[1-[1-(4-isocyanophenyl)ethyl]azetidin-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[1-[1-(4-isocyanophenyl)ethyl]azetidin-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 140732658 |
| Molecular Formula | C28H32N2OSi |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | tert-butyl-[1-[1-(4-isocyanophenyl)ethyl]azetidin-3-yl]oxy-diphenylsilane |
| SMILES | [C-]#[N+]c1ccc(C(C)N2CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C28H32N2OSi/c1-22(23-16-18-24(29-5)19-17-23)30-20-25(21-30)31-32(28(2,3)4,26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-19,22,25H,20-21H2,1-4H3 |
| InChIKey | ACLDBGBWQDADTD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|