C23H29N3OSi — CID 140943337
tert-butyl-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-diphenylsilane (PubChem CID 140943337) has the molecular formula C23H29N3OSi and a molecular weight of 391.59 g/mol. Its IUPAC name is tert-butyl-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-diphenylsilane |
|---|---|
| PubChem CID | 140943337 |
| Molecular Formula | C23H29N3OSi |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | tert-butyl-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-diphenylsilane |
| SMILES | Cc1nnc2n1CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC2 |
| InChI | InChI=1S/C23H29N3OSi/c1-18-24-25-22-16-15-19(17-26(18)22)27-28(23(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19H,15-17H2,1-4H3 |
| InChIKey | VLSAJECSWNOTFO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|