C23H28O2Si — CID 102008296
tert-butyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-6-en-3-yl]oxy]-diphenylsilane (PubChem CID 102008296) has the molecular formula C23H28O2Si and a molecular weight of 364.56 g/mol. Its IUPAC name is tert-butyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-6-en-3-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-6-en-3-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 102008296 |
| Molecular Formula | C23H28O2Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl-[[(1R,5S)-8-oxabicyclo[3.2.1]oct-6-en-3-yl]oxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC1C[C@H]2C=C[C@@H](C1)O2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28O2Si/c1-23(2,3)26(21-10-6-4-7-11-21,22-12-8-5-9-13-22)25-20-16-18-14-15-19(17-20)24-18/h4-15,18-20H,16-17H2,1-3H3/t18-,19+,20? |
| InChIKey | KTWKYUHVGZRKKR-YOFSQIOKSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|