C27H40O4Si — CID 11977280
2-[(2R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-(2-hydroxypropan-2-yl)oxan-2-yl]propan-2-ol (PubChem CID 11977280) has the molecular formula C27H40O4Si and a molecular weight of 456.70 g/mol. Its IUPAC name is 2-[(2R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-(2-hydroxypropan-2-yl)oxan-2-yl]propan-2-ol.
| Compound Name | 2-[(2R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-(2-hydroxypropan-2-yl)oxan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 11977280 |
| Molecular Formula | C27H40O4Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 2-[(2R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-(2-hydroxypropan-2-yl)oxan-2-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C27H40O4Si/c1-25(2,3)32(21-14-10-8-11-15-21,22-16-12-9-13-17-22)31-20-18-23(26(4,5)28)30-24(19-20)27(6,7)29/h8-17,20,23-24,28-29H,18-19H2,1-7H3/t23-,24-/m1/s1 |
| InChIKey | VYOSDHPGFSCUEW-DNQXCXABSA-N |
| XLogP | 4.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|