C24H33NOSi — CID 167381101
tert-butyl-[[(2S)-8-methyl-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]-diphenylsilane (PubChem CID 167381101) has the molecular formula C24H33NOSi and a molecular weight of 379.62 g/mol. Its IUPAC name is tert-butyl-[[(2S)-8-methyl-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S)-8-methyl-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 167381101 |
| Molecular Formula | C24H33NOSi |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | tert-butyl-[[(2S)-8-methyl-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]-diphenylsilane |
| SMILES | CC12CCCN1C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C2 |
| InChI | InChI=1S/C24H33NOSi/c1-23(2,3)27(21-12-7-5-8-13-21,22-14-9-6-10-15-22)26-20-18-24(4)16-11-17-25(24)19-20/h5-10,12-15,20H,11,16-19H2,1-4H3/t20-,24?/m0/s1 |
| InChIKey | DJOVGDZANBAJRJ-QHELBMECSA-N |
| XLogP | 4.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|