C24H31NO4Si — CID 174057201
2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid (PubChem CID 174057201) has the molecular formula C24H31NO4Si and a molecular weight of 425.60 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid |
|---|---|
| PubChem CID | 174057201 |
| Molecular Formula | C24H31NO4Si |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid |
| SMILES | CC(C)(C)[Si](OC1CN2CC(O)CC2(C(=O)O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO4Si/c1-23(2,3)30(20-10-6-4-7-11-20,21-12-8-5-9-13-21)29-19-15-24(22(27)28)14-18(26)16-25(24)17-19/h4-13,18-19,26H,14-17H2,1-3H3,(H,27,28) |
| InChIKey | WRTWABHGYNWWLZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|