C23H29NO5Si — CID 175889399
(4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-methoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 175889399) has the molecular formula C23H29NO5Si and a molecular weight of 427.57 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-methoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-methoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175889399 |
| Molecular Formula | C23H29NO5Si |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-methoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)N1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1C(=O)O |
| InChI | InChI=1S/C23H29NO5Si/c1-23(2,3)30(18-11-7-5-8-12-18,19-13-9-6-10-14-19)29-17-15-20(21(25)26)24(16-17)22(27)28-4/h5-14,17,20H,15-16H2,1-4H3,(H,25,26)/t17-,20?/m0/s1 |
| InChIKey | CWSNORHOTZHQDJ-DIMJTDRSSA-N |
| XLogP | 2.86 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|