C30H33F3N2O5Si — CID 70975932
methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[[4-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-2-carboxylate (PubChem CID 70975932) has the molecular formula C30H33F3N2O5Si and a molecular weight of 586.68 g/mol. Its IUPAC name is methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[[4-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[[4-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70975932 |
| Molecular Formula | C30H33F3N2O5Si |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[[4-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C30H33F3N2O5Si/c1-29(2,3)41(24-11-7-5-8-12-24,25-13-9-6-10-14-25)40-23-19-26(27(36)38-4)35(20-23)28(37)34-21-15-17-22(18-16-21)39-30(31,32)33/h5-18,23,26H,19-20H2,1-4H3,(H,34,37)/t23-,26+/m1/s1 |
| InChIKey | FRLOFYNNMQHZNR-BVAGGSTKSA-N |
| XLogP | 5.31 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|