C29H40O5Si — CID 162424135
1-O-tert-butyl 2-O-methyl (1R,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-dicarboxylate (PubChem CID 162424135) has the molecular formula C29H40O5Si and a molecular weight of 496.72 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (1R,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (1R,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 162424135 |
| Molecular Formula | C29H40O5Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (1R,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H40O5Si/c1-28(2,3)33-27(31)24-19-18-21(20-25(24)26(30)32-7)34-35(29(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,21,24-25H,18-20H2,1-7H3/t21-,24+,25-/m0/s1 |
| InChIKey | MWYWOGXMYUPFQV-GPUOULLFSA-N |
| XLogP | 4.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|