C24H30O4Si — CID 54720201
methyl (5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxycyclohexene-1-carboxylate (PubChem CID 54720201) has the molecular formula C24H30O4Si and a molecular weight of 410.59 g/mol. Its IUPAC name is methyl (5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxycyclohexene-1-carboxylate.
| Compound Name | methyl (5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 54720201 |
| Molecular Formula | C24H30O4Si |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | methyl (5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(O)CC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H30O4Si/c1-24(2,3)29(19-11-7-5-8-12-19,20-13-9-6-10-14-20)28-18-15-16-22(25)21(17-18)23(26)27-4/h5-14,18,25H,15-17H2,1-4H3/t18-/m0/s1 |
| InChIKey | NTECEDXIWUUGGL-SFHVURJKSA-N |
| XLogP | 4.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|