C25H35NO3Si — CID 89407420
4-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methylcyclohexane-1-carboxamide (PubChem CID 89407420) has the molecular formula C25H35NO3Si and a molecular weight of 425.65 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methylcyclohexane-1-carboxamide.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 89407420 |
| Molecular Formula | C25H35NO3Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methylcyclohexane-1-carboxamide |
| SMILES | CON(C)C(=O)C1CCC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H35NO3Si/c1-25(2,3)30(22-12-8-6-9-13-22,23-14-10-7-11-15-23)29-21-18-16-20(17-19-21)24(27)26(4)28-5/h6-15,20-21H,16-19H2,1-5H3 |
| InChIKey | SNROPVCLBIHBID-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|