C33H49NO4Si — CID 69315149
tert-butyl 2-[[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexanecarbonyl]-methylamino]-3-methylbutanoate (PubChem CID 69315149) has the molecular formula C33H49NO4Si and a molecular weight of 551.84 g/mol. Its IUPAC name is tert-butyl 2-[[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexanecarbonyl]-methylamino]-3-methylbutanoate.
| Compound Name | tert-butyl 2-[[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexanecarbonyl]-methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 69315149 |
| Molecular Formula | C33H49NO4Si |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | tert-butyl 2-[[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexanecarbonyl]-methylamino]-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OC(C)(C)C)N(C)C(=O)[C@H]1CCC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C33H49NO4Si/c1-24(2)29(31(36)37-32(3,4)5)34(9)30(35)25-17-16-18-26(23-25)38-39(33(6,7)8,27-19-12-10-13-20-27)28-21-14-11-15-22-28/h10-15,19-22,24-26,29H,16-18,23H2,1-9H3/t25-,26+,29?/m0/s1 |
| InChIKey | WBGINVOKWRJAQX-YTUWVCBBSA-N |
| XLogP | 5.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|