C26H38OSi — CID 58800360
tert-butyl-(3-butylcyclohexyl)oxy-diphenylsilane (PubChem CID 58800360) has the molecular formula C26H38OSi and a molecular weight of 394.68 g/mol. Its IUPAC name is tert-butyl-(3-butylcyclohexyl)oxy-diphenylsilane.
| Compound Name | tert-butyl-(3-butylcyclohexyl)oxy-diphenylsilane |
|---|---|
| PubChem CID | 58800360 |
| Molecular Formula | C26H38OSi |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | tert-butyl-(3-butylcyclohexyl)oxy-diphenylsilane |
| SMILES | CCCCC1CCCC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H38OSi/c1-5-6-14-22-15-13-16-23(21-22)27-28(26(2,3)4,24-17-9-7-10-18-24)25-19-11-8-12-20-25/h7-12,17-20,22-23H,5-6,13-16,21H2,1-4H3 |
| InChIKey | DLANMXWPMLZHKK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|