C25H33NO3Si — CID 23256423
methyl (4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(dimethylamino)cyclopentene-1-carboxylate (PubChem CID 23256423) has the molecular formula C25H33NO3Si and a molecular weight of 423.63 g/mol. Its IUPAC name is methyl (4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(dimethylamino)cyclopentene-1-carboxylate.
| Compound Name | methyl (4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(dimethylamino)cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 23256423 |
| Molecular Formula | C25H33NO3Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | methyl (4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(dimethylamino)cyclopentene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1N(C)C |
| InChI | InChI=1S/C25H33NO3Si/c1-25(2,3)30(19-13-9-7-10-14-19,20-15-11-8-12-16-20)29-22-18-17-21(24(27)28-6)23(22)26(4)5/h7-17,22-23H,18H2,1-6H3/t22-,23-/m0/s1 |
| InChIKey | BCTDPTDIXVLJOL-GOTSBHOMSA-N |
| XLogP | 3.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|