C25H33O3SSi+ — CID 23256427
[(1S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methoxycarbonylcyclopent-2-en-1-yl]-dimethylsulfanium (PubChem CID 23256427) has the molecular formula C25H33O3SSi+ and a molecular weight of 441.69 g/mol. Its IUPAC name is [(1S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methoxycarbonylcyclopent-2-en-1-yl]-dimethylsulfanium.
| Compound Name | [(1S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methoxycarbonylcyclopent-2-en-1-yl]-dimethylsulfanium |
|---|---|
| PubChem CID | 23256427 |
| Molecular Formula | C25H33O3SSi+ |
| Molecular Weight | 441.69 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [(1S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methoxycarbonylcyclopent-2-en-1-yl]-dimethylsulfanium |
| SMILES | COC(=O)C1=CC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1[S+](C)C |
| InChI | InChI=1S/C25H33O3SSi/c1-25(2,3)30(19-13-9-7-10-14-19,20-15-11-8-12-16-20)28-22-18-17-21(24(26)27-4)23(22)29(5)6/h7-17,22-23H,18H2,1-6H3/q+1/t22-,23-/m0/s1 |
| InChIKey | BVYXTZOLHCJQNB-GOTSBHOMSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|