C27H34O5Si — CID 171783207
methyl (1R,4aS,6S,7R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 171783207) has the molecular formula C27H34O5Si and a molecular weight of 466.65 g/mol. Its IUPAC name is methyl (1R,4aS,6S,7R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1R,4aS,6S,7R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 171783207 |
| Molecular Formula | C27H34O5Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | methyl (1R,4aS,6S,7R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](O)[C@@H]2[C@@H](C)[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]12 |
| InChI | InChI=1S/C27H34O5Si/c1-18-23(16-21-22(25(28)30-5)17-31-26(29)24(18)21)32-33(27(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,17-18,21,23-24,26,29H,16H2,1-5H3/t18-,21+,23-,24+,26+/m0/s1 |
| InChIKey | PVXVVKHWMSTCHC-AGYMKDPCSA-N |
| XLogP | 3.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|