C26H32O3Si — CID 99772296
(1R,4R,5S,7R,8S,10S)-8-[tert-butyl(diphenyl)silyl]oxy-5-hydroxytricyclo[5.2.1.04,10]decan-2-one (PubChem CID 99772296) has the molecular formula C26H32O3Si and a molecular weight of 420.63 g/mol. Its IUPAC name is (1R,4R,5S,7R,8S,10S)-8-[tert-butyl(diphenyl)silyl]oxy-5-hydroxytricyclo[5.2.1.04,10]decan-2-one.
| Compound Name | (1R,4R,5S,7R,8S,10S)-8-[tert-butyl(diphenyl)silyl]oxy-5-hydroxytricyclo[5.2.1.04,10]decan-2-one |
|---|---|
| PubChem CID | 99772296 |
| Molecular Formula | C26H32O3Si |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (1R,4R,5S,7R,8S,10S)-8-[tert-butyl(diphenyl)silyl]oxy-5-hydroxytricyclo[5.2.1.04,10]decan-2-one |
| SMILES | CC(C)(C)[Si](O[C@H]1C[C@H]2C(=O)C[C@@H]3[C@H]2[C@H]1C[C@@H]3O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32O3Si/c1-26(2,3)30(17-10-6-4-7-11-17,18-12-8-5-9-13-18)29-24-16-20-22(27)14-19-23(28)15-21(24)25(19)20/h4-13,19-21,23-25,28H,14-16H2,1-3H3/t19-,20-,21-,23-,24-,25+/m0/s1 |
| InChIKey | SKNAAGUCAHOXDL-ADOUWIFLSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|